C23H23NO2S2 — CID 126140496
(5E)-3-(cyclohexylmethyl)-5-[(4-phenylsulfanylphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126140496) has the molecular formula C23H23NO2S2 and a molecular weight of 409.58 g/mol. Its IUPAC name is (5E)-3-(cyclohexylmethyl)-5-[(4-phenylsulfanylphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-(cyclohexylmethyl)-5-[(4-phenylsulfanylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126140496 |
| Molecular Formula | C23H23NO2S2 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | (5E)-3-(cyclohexylmethyl)-5-[(4-phenylsulfanylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(Sc3ccccc3)cc2)C(=O)N1CC1CCCCC1 |
| InChI | InChI=1S/C23H23NO2S2/c25-22-21(28-23(26)24(22)16-18-7-3-1-4-8-18)15-17-11-13-20(14-12-17)27-19-9-5-2-6-10-19/h2,5-6,9-15,18H,1,3-4,7-8,16H2/b21-15+ |
| InChIKey | NRHKBOXFCHBQJJ-RCCKNPSSSA-N |
| XLogP | 6.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|