C28H24ClN3O3S2 — CID 6370938
(5E)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 6370938) has the molecular formula C28H24ClN3O3S2 and a molecular weight of 550.11 g/mol. Its IUPAC name is (5E)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 6370938 |
| Molecular Formula | C28H24ClN3O3S2 |
| Molecular Weight | 550.11 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | (5E)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(Sc3ccc(Cl)cc3)cc2)C1=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C28H24ClN3O3S2/c29-21-8-12-24(13-9-21)36-23-10-6-20(7-11-23)18-25-27(34)32(28(35)37-25)19-26(33)31-16-14-30(15-17-31)22-4-2-1-3-5-22/h1-13,18H,14-17,19H2/b25-18+ |
| InChIKey | YKTXOJOXULNZLI-XIEYBQDHSA-N |
| XLogP | 5.88 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.11 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|