C24H21Br2N3O6S — CID 4261643
2-[2,6-dibromo-4-[[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 4261643) has the molecular formula C24H21Br2N3O6S and a molecular weight of 639.32 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dibromo-4-[[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 4261643 |
| Molecular Formula | C24H21Br2N3O6S |
| Molecular Weight | 639.32 g/mol |
| Exact Mass | 636.95 |
| IUPAC Name | 2-[2,6-dibromo-4-[[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(Br)cc(C=C2SC(=O)N(CC(=O)N3CCN(c4ccccc4)CC3)C2=O)cc1Br |
| InChI | InChI=1S/C24H21Br2N3O6S/c25-17-10-15(11-18(26)22(17)35-14-21(31)32)12-19-23(33)29(24(34)36-19)13-20(30)28-8-6-27(7-9-28)16-4-2-1-3-5-16/h1-5,10-12H,6-9,13-14H2,(H,31,32) |
| InChIKey | FPSRRCSWPOEQNN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|