C29H24Br2ClN3O4S — CID 126204941
(5E)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126204941) has the molecular formula C29H24Br2ClN3O4S and a molecular weight of 705.86 g/mol. Its IUPAC name is (5E)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126204941 |
| Molecular Formula | C29H24Br2ClN3O4S |
| Molecular Weight | 705.86 g/mol |
| Exact Mass | 702.95 |
| IUPAC Name | (5E)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cc(Br)c(OCc3ccccc3Cl)c(Br)c2)C1=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C29H24Br2ClN3O4S/c30-22-14-19(15-23(31)27(22)39-18-20-6-4-5-9-24(20)32)16-25-28(37)35(29(38)40-25)17-26(36)34-12-10-33(11-13-34)21-7-2-1-3-8-21/h1-9,14-16H,10-13,17-18H2/b25-16+ |
| InChIKey | DIGGBVFLECMXJW-PCLIKHOPSA-N |
| XLogP | 6.83 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.86 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|