C24H24FNO3S — CID 126138654
(5E)-3-(cyclohexylmethyl)-5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126138654) has the molecular formula C24H24FNO3S and a molecular weight of 425.53 g/mol. Its IUPAC name is (5E)-3-(cyclohexylmethyl)-5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-(cyclohexylmethyl)-5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126138654 |
| Molecular Formula | C24H24FNO3S |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | (5E)-3-(cyclohexylmethyl)-5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2cccc(OCc3ccccc3F)c2)C(=O)N1CC1CCCCC1 |
| InChI | InChI=1S/C24H24FNO3S/c25-21-12-5-4-10-19(21)16-29-20-11-6-9-18(13-20)14-22-23(27)26(24(28)30-22)15-17-7-2-1-3-8-17/h4-6,9-14,17H,1-3,7-8,15-16H2/b22-14+ |
| InChIKey | ZZYKPWNBXOGAAR-HYARGMPZSA-N |
| XLogP | 6.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|