C29H26FN3O4S — CID 126024766
(5E)-5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126024766) has the molecular formula C29H26FN3O4S and a molecular weight of 531.61 g/mol. Its IUPAC name is (5E)-5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126024766 |
| Molecular Formula | C29H26FN3O4S |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | (5E)-5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cccc(OCc3ccccc3F)c2)C1=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C29H26FN3O4S/c30-25-12-5-4-8-22(25)20-37-24-11-6-7-21(17-24)18-26-28(35)33(29(36)38-26)19-27(34)32-15-13-31(14-16-32)23-9-2-1-3-10-23/h1-12,17-18H,13-16,19-20H2/b26-18+ |
| InChIKey | YDSZZEFSKWOENR-NLRVBDNBSA-N |
| XLogP | 4.79 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|