C21H18FNO5S — CID 126102789
methyl (2R)-2-[(5E)-5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126102789) has the molecular formula C21H18FNO5S and a molecular weight of 415.44 g/mol. Its IUPAC name is methyl (2R)-2-[(5E)-5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | methyl (2R)-2-[(5E)-5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126102789 |
| Molecular Formula | C21H18FNO5S |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | methyl (2R)-2-[(5E)-5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)N1C(=O)S/C(=C/c2cccc(OCc3ccccc3F)c2)C1=O |
| InChI | InChI=1S/C21H18FNO5S/c1-13(20(25)27-2)23-19(24)18(29-21(23)26)11-14-6-5-8-16(10-14)28-12-15-7-3-4-9-17(15)22/h3-11,13H,12H2,1-2H3/b18-11+/t13-/m1/s1 |
| InChIKey | DIFWKOSZMLBFQO-VBEHJTROSA-N |
| XLogP | 4.00 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|