C18H10N2O4S — CID 26790172
(5E)-5-benzylidene-3-(1,3-dioxoisoindol-2-yl)-1,3-thiazolidine-2,4-dione (PubChem CID 26790172) has the molecular formula C18H10N2O4S and a molecular weight of 350.36 g/mol. Its IUPAC name is (5E)-5-benzylidene-3-(1,3-dioxoisoindol-2-yl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-benzylidene-3-(1,3-dioxoisoindol-2-yl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 26790172 |
| Molecular Formula | C18H10N2O4S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | (5E)-5-benzylidene-3-(1,3-dioxoisoindol-2-yl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccccc2)C(=O)N1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H10N2O4S/c21-15-12-8-4-5-9-13(12)16(22)19(15)20-17(23)14(25-18(20)24)10-11-6-2-1-3-7-11/h1-10H/b14-10+ |
| InChIKey | PLKUCIGPQXHVMC-GXDHUFHOSA-N |
| XLogP | 2.93 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|