C19H14N2O4S — CID 3748290
5-benzylidene-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-1,3-thiazolidine-2,4-dione (PubChem CID 3748290) has the molecular formula C19H14N2O4S and a molecular weight of 366.40 g/mol. Its IUPAC name is 5-benzylidene-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-benzylidene-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3748290 |
| Molecular Formula | C19H14N2O4S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 5-benzylidene-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccccc2)C(=O)N1N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C19H14N2O4S/c22-16-13(8-10-4-2-1-3-5-10)26-19(25)21(16)20-17(23)14-11-6-7-12(9-11)15(14)18(20)24/h1-8,11-12,14-15H,9H2 |
| InChIKey | SUDVDXJUZPNXRY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|