C20H14N2O5S2 — CID 2331027
(5Z)-5-benzylidene-3-[2-[(5Z)-5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 2331027) has the molecular formula C20H14N2O5S2 and a molecular weight of 426.48 g/mol. Its IUPAC name is (5Z)-5-benzylidene-3-[2-[(5Z)-5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-benzylidene-3-[2-[(5Z)-5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2331027 |
| Molecular Formula | C20H14N2O5S2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | (5Z)-5-benzylidene-3-[2-[(5Z)-5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccccc2)C(=O)N1CCN1C(=O)S/C(=C\c2ccco2)C1=O |
| InChI | InChI=1S/C20H14N2O5S2/c23-17-15(11-13-5-2-1-3-6-13)28-19(25)21(17)8-9-22-18(24)16(29-20(22)26)12-14-7-4-10-27-14/h1-7,10-12H,8-9H2/b15-11-,16-12- |
| InChIKey | YEJVNEILXXLEMW-NFLUSIDLSA-N |
| XLogP | 4.05 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|