C15H17NO5S — CID 175559743
7-[5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]heptanoic acid (PubChem CID 175559743) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is 7-[5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]heptanoic acid.
| Compound Name | 7-[5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]heptanoic acid |
|---|---|
| PubChem CID | 175559743 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 7-[5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)SC(=Cc2ccco2)C1=O |
| InChI | InChI=1S/C15H17NO5S/c17-13(18)7-3-1-2-4-8-16-14(19)12(22-15(16)20)10-11-6-5-9-21-11/h5-6,9-10H,1-4,7-8H2,(H,17,18) |
| InChIKey | MSIMATURYRJXBQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|