C13H14N2O4S — CID 6182404
(5E)-5-(furan-2-ylmethylidene)-3-(morpholin-4-ylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 6182404) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is (5E)-5-(furan-2-ylmethylidene)-3-(morpholin-4-ylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-(furan-2-ylmethylidene)-3-(morpholin-4-ylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 6182404 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | (5E)-5-(furan-2-ylmethylidene)-3-(morpholin-4-ylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccco2)C(=O)N1CN1CCOCC1 |
| InChI | InChI=1S/C13H14N2O4S/c16-12-11(8-10-2-1-5-19-10)20-13(17)15(12)9-14-3-6-18-7-4-14/h1-2,5,8H,3-4,6-7,9H2/b11-8+ |
| InChIKey | DVPLCRJPONHNJX-DHZHZOJOSA-N |
| XLogP | 1.61 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|