C16H16N2O5S — CID 6123244
(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-3-(morpholin-4-ylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 6123244) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is (5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-3-(morpholin-4-ylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-3-(morpholin-4-ylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 6123244 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | (5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-3-(morpholin-4-ylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccc3c(c2)OCO3)C(=O)N1CN1CCOCC1 |
| InChI | InChI=1S/C16H16N2O5S/c19-15-14(8-11-1-2-12-13(7-11)23-10-22-12)24-16(20)18(15)9-17-3-5-21-6-4-17/h1-2,7-8H,3-6,9-10H2/b14-8- |
| InChIKey | BVHUUKAPHDVJOO-ZSOIEALJSA-N |
| XLogP | 1.74 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|