C20H26N2O4S — CID 4645064
5-(1,3-benzodioxol-5-ylmethylidene)-3-[(dibutylamino)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 4645064) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylidene)-3-[(dibutylamino)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethylidene)-3-[(dibutylamino)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4645064 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethylidene)-3-[(dibutylamino)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCN(CCCC)CN1C(=O)SC(=Cc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C20H26N2O4S/c1-3-5-9-21(10-6-4-2)13-22-19(23)18(27-20(22)24)12-15-7-8-16-17(11-15)26-14-25-16/h7-8,11-12H,3-6,9-10,13-14H2,1-2H3 |
| InChIKey | QWZBFPZYZXJMPU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|