C22H32N2O2S — CID 6088855
(5E)-3-[(dibutylamino)methyl]-5-[(4-propan-2-ylphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 6088855) has the molecular formula C22H32N2O2S and a molecular weight of 388.58 g/mol. Its IUPAC name is (5E)-3-[(dibutylamino)methyl]-5-[(4-propan-2-ylphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(dibutylamino)methyl]-5-[(4-propan-2-ylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 6088855 |
| Molecular Formula | C22H32N2O2S |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (5E)-3-[(dibutylamino)methyl]-5-[(4-propan-2-ylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCN(CCCC)CN1C(=O)S/C(=C/c2ccc(C(C)C)cc2)C1=O |
| InChI | InChI=1S/C22H32N2O2S/c1-5-7-13-23(14-8-6-2)16-24-21(25)20(27-22(24)26)15-18-9-11-19(12-10-18)17(3)4/h9-12,15,17H,5-8,13-14,16H2,1-4H3/b20-15+ |
| InChIKey | IMKPJSHEMYKOEV-HMMYKYKNSA-N |
| XLogP | 5.71 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|