C20H17ClN2O6S — CID 4684949
5-(1,3-benzodioxol-5-ylmethylidene)-3-[(5-chloro-2,4-dimethoxyanilino)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 4684949) has the molecular formula C20H17ClN2O6S and a molecular weight of 448.88 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylidene)-3-[(5-chloro-2,4-dimethoxyanilino)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethylidene)-3-[(5-chloro-2,4-dimethoxyanilino)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4684949 |
| Molecular Formula | C20H17ClN2O6S |
| Molecular Weight | 448.88 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethylidene)-3-[(5-chloro-2,4-dimethoxyanilino)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(OC)c(NCN2C(=O)SC(=Cc3ccc4c(c3)OCO4)C2=O)cc1Cl |
| InChI | InChI=1S/C20H17ClN2O6S/c1-26-15-8-16(27-2)13(7-12(15)21)22-9-23-19(24)18(30-20(23)25)6-11-3-4-14-17(5-11)29-10-28-14/h3-8,22H,9-10H2,1-2H3 |
| InChIKey | DKJRFUQUWUIZIL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.88 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|