C18H14N2O4S — CID 5374584
(5Z)-3-(anilinomethyl)-5-(1,3-benzodioxol-5-ylmethylidene)-1,3-thiazolidine-2,4-dione (PubChem CID 5374584) has the molecular formula C18H14N2O4S and a molecular weight of 354.39 g/mol. Its IUPAC name is (5Z)-3-(anilinomethyl)-5-(1,3-benzodioxol-5-ylmethylidene)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-(anilinomethyl)-5-(1,3-benzodioxol-5-ylmethylidene)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 5374584 |
| Molecular Formula | C18H14N2O4S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | (5Z)-3-(anilinomethyl)-5-(1,3-benzodioxol-5-ylmethylidene)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccc3c(c2)OCO3)C(=O)N1CNc1ccccc1 |
| InChI | InChI=1S/C18H14N2O4S/c21-17-16(9-12-6-7-14-15(8-12)24-11-23-14)25-18(22)20(17)10-19-13-4-2-1-3-5-13/h1-9,19H,10-11H2/b16-9- |
| InChIKey | OSMUXDHHXIZFJG-SXGWCWSVSA-N |
| XLogP | 3.52 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|