C27H22N2O5S — CID 2675558
N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2,2-diphenylacetamide (PubChem CID 2675558) has the molecular formula C27H22N2O5S and a molecular weight of 486.55 g/mol. Its IUPAC name is N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2,2-diphenylacetamide.
| Compound Name | N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 2675558 |
| Molecular Formula | C27H22N2O5S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2,2-diphenylacetamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C/c2ccc3c(c2)OCO3)C1=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H22N2O5S/c30-25(24(19-7-3-1-4-8-19)20-9-5-2-6-10-20)28-13-14-29-26(31)23(35-27(29)32)16-18-11-12-21-22(15-18)34-17-33-21/h1-12,15-16,24H,13-14,17H2,(H,28,30)/b23-16+ |
| InChIKey | WGIKJYLWESEGSP-XQNSMLJCSA-N |
| XLogP | 4.40 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|