C23H19N3O6S — CID 55598067
N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2-cyanophenoxy)propanamide (PubChem CID 55598067) has the molecular formula C23H19N3O6S and a molecular weight of 465.49 g/mol. Its IUPAC name is N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2-cyanophenoxy)propanamide.
| Compound Name | N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2-cyanophenoxy)propanamide |
|---|---|
| PubChem CID | 55598067 |
| Molecular Formula | C23H19N3O6S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2-cyanophenoxy)propanamide |
| SMILES | CC(Oc1ccccc1C#N)C(=O)NCCN1C(=O)S/C(=C/c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C23H19N3O6S/c1-14(32-17-5-3-2-4-16(17)12-24)21(27)25-8-9-26-22(28)20(33-23(26)29)11-15-6-7-18-19(10-15)31-13-30-18/h2-7,10-11,14H,8-9,13H2,1H3,(H,25,27)/b20-11+ |
| InChIKey | QUDHXEMIQRVQJK-RGVLZGJSSA-N |
| XLogP | 2.91 |
| TPSA | 117.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|