C22H20N2O5S2 — CID 17478362
N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-phenylsulfanylpropanamide (PubChem CID 17478362) has the molecular formula C22H20N2O5S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-phenylsulfanylpropanamide.
| Compound Name | N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 17478362 |
| Molecular Formula | C22H20N2O5S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-phenylsulfanylpropanamide |
| SMILES | CC(Sc1ccccc1)C(=O)NCCN1C(=O)S/C(=C\c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C22H20N2O5S2/c1-14(30-16-5-3-2-4-6-16)20(25)23-9-10-24-21(26)19(31-22(24)27)12-15-7-8-17-18(11-15)29-13-28-17/h2-8,11-12,14H,9-10,13H2,1H3,(H,23,25)/b19-12- |
| InChIKey | VRFHDQLQPGSBOF-UNOMPAQXSA-N |
| XLogP | 3.75 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|