C22H25N3O6S — CID 55974021
1-acetamido-N-[2-[5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]cyclohexane-1-carboxamide (PubChem CID 55974021) has the molecular formula C22H25N3O6S and a molecular weight of 459.52 g/mol. Its IUPAC name is 1-acetamido-N-[2-[5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]cyclohexane-1-carboxamide.
| Compound Name | 1-acetamido-N-[2-[5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 55974021 |
| Molecular Formula | C22H25N3O6S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 1-acetamido-N-[2-[5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]cyclohexane-1-carboxamide |
| SMILES | CC(=O)NC1(C(=O)NCCN2C(=O)SC(=Cc3ccc4c(c3)OCO4)C2=O)CCCCC1 |
| InChI | InChI=1S/C22H25N3O6S/c1-14(26)24-22(7-3-2-4-8-22)20(28)23-9-10-25-19(27)18(32-21(25)29)12-15-5-6-16-17(11-15)31-13-30-16/h5-6,11-12H,2-4,7-10,13H2,1H3,(H,23,28)(H,24,26) |
| InChIKey | XQQAZRBBTGYILG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|