C24H24N2O6S — CID 2675316
N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,4,6-trimethylphenoxy)acetamide (PubChem CID 2675316) has the molecular formula C24H24N2O6S and a molecular weight of 468.53 g/mol. Its IUPAC name is N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,4,6-trimethylphenoxy)acetamide.
| Compound Name | N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,4,6-trimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 2675316 |
| Molecular Formula | C24H24N2O6S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,4,6-trimethylphenoxy)acetamide |
| SMILES | Cc1cc(C)c(OCC(=O)NCCN2C(=O)S/C(=C\c3ccc4c(c3)OCO4)C2=O)c(C)c1 |
| InChI | InChI=1S/C24H24N2O6S/c1-14-8-15(2)22(16(3)9-14)30-12-21(27)25-6-7-26-23(28)20(33-24(26)29)11-17-4-5-18-19(10-17)32-13-31-18/h4-5,8-11H,6-7,12-13H2,1-3H3,(H,25,27)/b20-11- |
| InChIKey | HWVCUTNBDPKYEW-JAIQZWGSSA-N |
| XLogP | 3.57 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|