C24H22N2O6S — CID 2635885
N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,3-dihydro-1H-inden-5-yloxy)acetamide (PubChem CID 2635885) has the molecular formula C24H22N2O6S and a molecular weight of 466.52 g/mol. Its IUPAC name is N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,3-dihydro-1H-inden-5-yloxy)acetamide.
| Compound Name | N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,3-dihydro-1H-inden-5-yloxy)acetamide |
|---|---|
| PubChem CID | 2635885 |
| Molecular Formula | C24H22N2O6S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,3-dihydro-1H-inden-5-yloxy)acetamide |
| SMILES | O=C(COc1ccc2c(c1)CCC2)NCCN1C(=O)S/C(=C/c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C24H22N2O6S/c27-22(13-30-18-6-5-16-2-1-3-17(16)12-18)25-8-9-26-23(28)21(33-24(26)29)11-15-4-7-19-20(10-15)32-14-31-19/h4-7,10-12H,1-3,8-9,13-14H2,(H,25,27)/b21-11+ |
| InChIKey | OGSJZBMIKUXDBW-SRZZPIQSSA-N |
| XLogP | 3.14 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|