C22H19ClN2O6S — CID 2675673
(2R)-N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(4-chlorophenoxy)propanamide (PubChem CID 2675673) has the molecular formula C22H19ClN2O6S and a molecular weight of 474.92 g/mol. Its IUPAC name is (2R)-N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(4-chlorophenoxy)propanamide.
| Compound Name | (2R)-N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(4-chlorophenoxy)propanamide |
|---|---|
| PubChem CID | 2675673 |
| Molecular Formula | C22H19ClN2O6S |
| Molecular Weight | 474.92 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | (2R)-N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(4-chlorophenoxy)propanamide |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1)C(=O)NCCN1C(=O)S/C(=C\c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C22H19ClN2O6S/c1-13(31-16-5-3-15(23)4-6-16)20(26)24-8-9-25-21(27)19(32-22(25)28)11-14-2-7-17-18(10-14)30-12-29-17/h2-7,10-11,13H,8-9,12H2,1H3,(H,24,26)/b19-11-/t13-/m1/s1 |
| InChIKey | CODCCCHHBXHPLY-LPXFMOJISA-N |
| XLogP | 3.69 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.92 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|