C20H18ClN3O4S — CID 6290014
2-(4-chlorophenoxy)-N-[2-[(5E)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]propanamide (PubChem CID 6290014) has the molecular formula C20H18ClN3O4S and a molecular weight of 431.90 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[2-[(5E)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]propanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[2-[(5E)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 6290014 |
| Molecular Formula | C20H18ClN3O4S |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[2-[(5E)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1)C(=O)NCCN1C(=O)S/C(=C/c2cccnc2)C1=O |
| InChI | InChI=1S/C20H18ClN3O4S/c1-13(28-16-6-4-15(21)5-7-16)18(25)23-9-10-24-19(26)17(29-20(24)27)11-14-3-2-8-22-12-14/h2-8,11-13H,9-10H2,1H3,(H,23,25)/b17-11+ |
| InChIKey | UJKSBOJNOHUYQE-GZTJUZNOSA-N |
| XLogP | 3.36 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|