C20H16ClN3O4S — CID 17471498
5-chloro-N-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 17471498) has the molecular formula C20H16ClN3O4S and a molecular weight of 429.89 g/mol. Its IUPAC name is 5-chloro-N-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 17471498 |
| Molecular Formula | C20H16ClN3O4S |
| Molecular Weight | 429.89 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 5-chloro-N-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2cccnc2)C1=O)C1Cc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C20H16ClN3O4S/c21-14-3-4-15-13(9-14)10-16(28-15)18(25)23-6-7-24-19(26)17(29-20(24)27)8-12-2-1-5-22-11-12/h1-5,8-9,11,16H,6-7,10H2,(H,23,25)/b17-8- |
| InChIKey | OQUXNLFPPWDPCK-IUXPMGMMSA-N |
| XLogP | 2.89 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.89 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|