C16H13N5O4S — CID 2122433
N-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 2122433) has the molecular formula C16H13N5O4S and a molecular weight of 371.38 g/mol. Its IUPAC name is N-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 2122433 |
| Molecular Formula | C16H13N5O4S |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2cccnc2)C1=O)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C16H13N5O4S/c22-13-4-3-11(19-20-13)14(23)18-6-7-21-15(24)12(26-16(21)25)8-10-2-1-5-17-9-10/h1-5,8-9H,6-7H2,(H,18,23)(H,20,22)/b12-8- |
| InChIKey | BGQWUAGDTHMRLX-WQLSENKSSA-N |
| XLogP | 0.63 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|