C22H19N5O4S — CID 4265995
N-[2-[2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxamide (PubChem CID 4265995) has the molecular formula C22H19N5O4S and a molecular weight of 449.49 g/mol. Its IUPAC name is N-[2-[2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | N-[2-[2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 4265995 |
| Molecular Formula | C22H19N5O4S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | N-[2-[2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxamide |
| SMILES | O=C(NCCN1C(=O)SC(=Cc2cccnc2)C1=O)C1=NN(c2ccccc2)C(=O)CC1 |
| InChI | InChI=1S/C22H19N5O4S/c28-19-9-8-17(25-27(19)16-6-2-1-3-7-16)20(29)24-11-12-26-21(30)18(32-22(26)31)13-15-5-4-10-23-14-15/h1-7,10,13-14H,8-9,11-12H2,(H,24,29) |
| InChIKey | GDLSFGODJDKTJK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 112.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|