C23H21N5O4S — CID 16546856
N-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-4-oxo-3-propylphthalazine-1-carboxamide (PubChem CID 16546856) has the molecular formula C23H21N5O4S and a molecular weight of 463.52 g/mol. Its IUPAC name is N-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-4-oxo-3-propylphthalazine-1-carboxamide.
| Compound Name | N-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-4-oxo-3-propylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 16546856 |
| Molecular Formula | C23H21N5O4S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | N-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-4-oxo-3-propylphthalazine-1-carboxamide |
| SMILES | CCCn1nc(C(=O)NCCN2C(=O)S/C(=C\c3cccnc3)C2=O)c2ccccc2c1=O |
| InChI | InChI=1S/C23H21N5O4S/c1-2-11-28-21(30)17-8-4-3-7-16(17)19(26-28)20(29)25-10-12-27-22(31)18(33-23(27)32)13-15-6-5-9-24-14-15/h3-9,13-14H,2,10-12H2,1H3,(H,25,29)/b18-13- |
| InChIKey | PSFPNVWVKMHBCG-AQTBWJFISA-N |
| XLogP | 2.67 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|