C24H22N4O5S — CID 2409706
2-butyl-N-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 2409706) has the molecular formula C24H22N4O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is 2-butyl-N-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-butyl-N-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 2409706 |
| Molecular Formula | C24H22N4O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 2-butyl-N-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)NCCN3C(=O)S/C(=C\c4cccnc4)C3=O)cc2C1=O |
| InChI | InChI=1S/C24H22N4O5S/c1-2-3-10-27-21(30)17-7-6-16(13-18(17)22(27)31)20(29)26-9-11-28-23(32)19(34-24(28)33)12-15-5-4-8-25-14-15/h4-8,12-14H,2-3,9-11H2,1H3,(H,26,29)/b19-12- |
| InChIKey | BJGACFRFPDMHLU-UNOMPAQXSA-N |
| XLogP | 2.94 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|