C13H11N2O4S- — CID 7006718
4-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]butanoate (PubChem CID 7006718) has the molecular formula C13H11N2O4S- and a molecular weight of 291.31 g/mol. Its IUPAC name is 4-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]butanoate.
| Compound Name | 4-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 7006718 |
| Molecular Formula | C13H11N2O4S- |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 4-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]butanoate |
| SMILES | O=C([O-])CCCN1C(=O)S/C(=C\c2cccnc2)C1=O |
| InChI | InChI=1S/C13H12N2O4S/c16-11(17)4-2-6-15-12(18)10(20-13(15)19)7-9-3-1-5-14-8-9/h1,3,5,7-8H,2,4,6H2,(H,16,17)/p-1/b10-7- |
| InChIKey | HNILBIMYWFRCFN-YFHOEESVSA-M |
| XLogP | 0.65 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|