C27H18Cl2N4O5S — CID 2122582
N-[2-[(5Z)-5-[(3,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide (PubChem CID 2122582) has the molecular formula C27H18Cl2N4O5S and a molecular weight of 581.44 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(3,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-[2-[(5Z)-5-[(3,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 2122582 |
| Molecular Formula | C27H18Cl2N4O5S |
| Molecular Weight | 581.44 g/mol |
| Exact Mass | 580.04 |
| IUPAC Name | N-[2-[(5Z)-5-[(3,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccc(Cl)c(Cl)c2)C1=O)c1ccc2c(c1)C(=O)N(Cc1ccncc1)C2=O |
| InChI | InChI=1S/C27H18Cl2N4O5S/c28-20-4-1-16(11-21(20)29)12-22-26(37)32(27(38)39-22)10-9-31-23(34)17-2-3-18-19(13-17)25(36)33(24(18)35)14-15-5-7-30-8-6-15/h1-8,11-13H,9-10,14H2,(H,31,34)/b22-12- |
| InChIKey | XWRRJJRBCFNCDY-UUYOSTAYSA-N |
| XLogP | 4.65 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|