C17H11Cl3N2O3 — CID 113082254
3,4-dichloro-N-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]benzamide (PubChem CID 113082254) has the molecular formula C17H11Cl3N2O3 and a molecular weight of 397.65 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 113082254 |
| Molecular Formula | C17H11Cl3N2O3 |
| Molecular Weight | 397.65 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 3,4-dichloro-N-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]benzamide |
| SMILES | O=C(NCCN1C(=O)c2ccc(Cl)cc2C1=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H11Cl3N2O3/c18-10-2-3-11-12(8-10)17(25)22(16(11)24)6-5-21-15(23)9-1-4-13(19)14(20)7-9/h1-4,7-8H,5-6H2,(H,21,23) |
| InChIKey | DXQLZODGLMSPMX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.65 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|