C14H14ClN3O3 — CID 113082293
1-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]-3-cyclopropylurea (PubChem CID 113082293) has the molecular formula C14H14ClN3O3 and a molecular weight of 307.74 g/mol. Its IUPAC name is 1-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]-3-cyclopropylurea.
| Compound Name | 1-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 113082293 |
| Molecular Formula | C14H14ClN3O3 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 1-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]-3-cyclopropylurea |
| SMILES | O=C(NCCN1C(=O)c2ccc(Cl)cc2C1=O)NC1CC1 |
| InChI | InChI=1S/C14H14ClN3O3/c15-8-1-4-10-11(7-8)13(20)18(12(10)19)6-5-16-14(21)17-9-2-3-9/h1,4,7,9H,2-3,5-6H2,(H2,16,17,21) |
| InChIKey | DBJJDELRLLENNJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|