C17H13ClFN3O3 — CID 108875010
1-(3-chloro-4-fluorophenyl)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]urea (PubChem CID 108875010) has the molecular formula C17H13ClFN3O3 and a molecular weight of 361.76 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]urea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 108875010 |
| Molecular Formula | C17H13ClFN3O3 |
| Molecular Weight | 361.76 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]urea |
| SMILES | O=C(NCCN1C(=O)c2ccccc2C1=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H13ClFN3O3/c18-13-9-10(5-6-14(13)19)21-17(25)20-7-8-22-15(23)11-3-1-2-4-12(11)16(22)24/h1-6,9H,7-8H2,(H2,20,21,25) |
| InChIKey | KQTYAMGSLBLSOY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.76 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|