C19H17N3O5 — CID 108874981
methyl 4-[2-(1,3-dioxoisoindol-2-yl)ethylcarbamoylamino]benzoate (PubChem CID 108874981) has the molecular formula C19H17N3O5 and a molecular weight of 367.36 g/mol. Its IUPAC name is methyl 4-[2-(1,3-dioxoisoindol-2-yl)ethylcarbamoylamino]benzoate.
| Compound Name | methyl 4-[2-(1,3-dioxoisoindol-2-yl)ethylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 108874981 |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | methyl 4-[2-(1,3-dioxoisoindol-2-yl)ethylcarbamoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)NCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C19H17N3O5/c1-27-18(25)12-6-8-13(9-7-12)21-19(26)20-10-11-22-16(23)14-4-2-3-5-15(14)17(22)24/h2-9H,10-11H2,1H3,(H2,20,21,26) |
| InChIKey | RPNDNRUONDYECM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|