C16H14N4O3 — CID 113082169
1-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]-3-phenylurea (PubChem CID 113082169) has the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. Its IUPAC name is 1-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]-3-phenylurea.
| Compound Name | 1-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]-3-phenylurea |
|---|---|
| PubChem CID | 113082169 |
| Molecular Formula | C16H14N4O3 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]-3-phenylurea |
| SMILES | O=C(NCCN1C(=O)c2cccnc2C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H14N4O3/c21-14-12-7-4-8-17-13(12)15(22)20(14)10-9-18-16(23)19-11-5-2-1-3-6-11/h1-8H,9-10H2,(H2,18,19,23) |
| InChIKey | VSXVBVUSXMKFBZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|