C16H13ClN4O3 — CID 48805192
1-(2-chloro-3-pyridinyl)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]urea (PubChem CID 48805192) has the molecular formula C16H13ClN4O3 and a molecular weight of 344.76 g/mol. Its IUPAC name is 1-(2-chloro-3-pyridinyl)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]urea.
| Compound Name | 1-(2-chloro-3-pyridinyl)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 48805192 |
| Molecular Formula | C16H13ClN4O3 |
| Molecular Weight | 344.76 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-(2-chloro-3-pyridinyl)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]urea |
| SMILES | O=C(NCCN1C(=O)c2ccccc2C1=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C16H13ClN4O3/c17-13-12(6-3-7-18-13)20-16(24)19-8-9-21-14(22)10-4-1-2-5-11(10)15(21)23/h1-7H,8-9H2,(H2,19,20,24) |
| InChIKey | LRGVJCUEGKXQOE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.76 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|