C18H17N3O4 — CID 108874935
1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(2-hydroxy-5-methylphenyl)urea (PubChem CID 108874935) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(2-hydroxy-5-methylphenyl)urea.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(2-hydroxy-5-methylphenyl)urea |
|---|---|
| PubChem CID | 108874935 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(2-hydroxy-5-methylphenyl)urea |
| SMILES | Cc1ccc(O)c(NC(=O)NCCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C18H17N3O4/c1-11-6-7-15(22)14(10-11)20-18(25)19-8-9-21-16(23)12-4-2-3-5-13(12)17(21)24/h2-7,10,22H,8-9H2,1H3,(H2,19,20,25) |
| InChIKey | RYUABEWHYIOJML-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|