C18H14N4O3 — CID 108874812
1-(2-cyanophenyl)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]urea (PubChem CID 108874812) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]urea.
| Compound Name | 1-(2-cyanophenyl)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 108874812 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-(2-cyanophenyl)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]urea |
| SMILES | N#Cc1ccccc1NC(=O)NCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H14N4O3/c19-11-12-5-1-4-8-15(12)21-18(25)20-9-10-22-16(23)13-6-2-3-7-14(13)17(22)24/h1-8H,9-10H2,(H2,20,21,25) |
| InChIKey | XQOABJBCXJNTPP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|