C13H12N6O3 — CID 108875000
1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(1H-1,2,4-triazol-5-yl)urea (PubChem CID 108875000) has the molecular formula C13H12N6O3 and a molecular weight of 300.28 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(1H-1,2,4-triazol-5-yl)urea.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(1H-1,2,4-triazol-5-yl)urea |
|---|---|
| PubChem CID | 108875000 |
| Molecular Formula | C13H12N6O3 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(1H-1,2,4-triazol-5-yl)urea |
| SMILES | O=C(NCCN1C(=O)c2ccccc2C1=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C13H12N6O3/c20-10-8-3-1-2-4-9(8)11(21)19(10)6-5-14-13(22)17-12-15-7-16-18-12/h1-4,7H,5-6H2,(H3,14,15,16,17,18,22) |
| InChIKey | FDMOSCLCWOHONO-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|