C17H23N5O3 — CID 108874901
1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(2-piperazin-1-ylethyl)urea (PubChem CID 108874901) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(2-piperazin-1-ylethyl)urea.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(2-piperazin-1-ylethyl)urea |
|---|---|
| PubChem CID | 108874901 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(2-piperazin-1-ylethyl)urea |
| SMILES | O=C(NCCN1CCNCC1)NCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H23N5O3/c23-15-13-3-1-2-4-14(13)16(24)22(15)12-8-20-17(25)19-7-11-21-9-5-18-6-10-21/h1-4,18H,5-12H2,(H2,19,20,25) |
| InChIKey | XEQGXOKBBYJLGN-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|