C18H24N6O5 — CID 108890183
1-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]-3-(2-piperazin-1-ylethyl)urea (PubChem CID 108890183) has the molecular formula C18H24N6O5 and a molecular weight of 404.43 g/mol. Its IUPAC name is 1-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]-3-(2-piperazin-1-ylethyl)urea.
| Compound Name | 1-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]-3-(2-piperazin-1-ylethyl)urea |
|---|---|
| PubChem CID | 108890183 |
| Molecular Formula | C18H24N6O5 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 1-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]-3-(2-piperazin-1-ylethyl)urea |
| SMILES | O=C(NCCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C18H24N6O5/c25-16-14-3-2-13(24(28)29)12-15(14)17(26)23(16)8-1-4-20-18(27)21-7-11-22-9-5-19-6-10-22/h2-3,12,19H,1,4-11H2,(H2,20,21,27) |
| InChIKey | ZFLQBCXNTALAIQ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|