C18H14Cl2N4O5 — CID 108890309
1-(3,5-dichlorophenyl)-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea (PubChem CID 108890309) has the molecular formula C18H14Cl2N4O5 and a molecular weight of 437.24 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 108890309 |
| Molecular Formula | C18H14Cl2N4O5 |
| Molecular Weight | 437.24 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea |
| SMILES | O=C(NCCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H14Cl2N4O5/c19-10-6-11(20)8-12(7-10)22-18(27)21-4-1-5-23-16(25)14-3-2-13(24(28)29)9-15(14)17(23)26/h2-3,6-9H,1,4-5H2,(H2,21,22,27) |
| InChIKey | KINKVXDTNDOYIM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|