C20H18N4O6 — CID 108890162
1-(4-acetylphenyl)-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea (PubChem CID 108890162) has the molecular formula C20H18N4O6 and a molecular weight of 410.39 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea.
| Compound Name | 1-(4-acetylphenyl)-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 108890162 |
| Molecular Formula | C20H18N4O6 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 1-(4-acetylphenyl)-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea |
| SMILES | CC(=O)c1ccc(NC(=O)NCCCN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)cc1 |
| InChI | InChI=1S/C20H18N4O6/c1-12(25)13-3-5-14(6-4-13)22-20(28)21-9-2-10-23-18(26)16-8-7-15(24(29)30)11-17(16)19(23)27/h3-8,11H,2,9-10H2,1H3,(H2,21,22,28) |
| InChIKey | COMIGCJGLCMELP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|