C16H19N5O6 — CID 108890314
N-[2-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propylcarbamoylamino]ethyl]acetamide (PubChem CID 108890314) has the molecular formula C16H19N5O6 and a molecular weight of 377.36 g/mol. Its IUPAC name is N-[2-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propylcarbamoylamino]ethyl]acetamide.
| Compound Name | N-[2-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propylcarbamoylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 108890314 |
| Molecular Formula | C16H19N5O6 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-[2-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propylcarbamoylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNC(=O)NCCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C16H19N5O6/c1-10(22)17-6-7-19-16(25)18-5-2-8-20-14(23)12-4-3-11(21(26)27)9-13(12)15(20)24/h3-4,9H,2,5-8H2,1H3,(H,17,22)(H2,18,19,25) |
| InChIKey | GNMAWLJBQHUMMQ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 150.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|