C18H17N5O5 — CID 108890185
1-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]-3-(pyridin-4-ylmethyl)urea (PubChem CID 108890185) has the molecular formula C18H17N5O5 and a molecular weight of 383.36 g/mol. Its IUPAC name is 1-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]-3-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]-3-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 108890185 |
| Molecular Formula | C18H17N5O5 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 1-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]-3-(pyridin-4-ylmethyl)urea |
| SMILES | O=C(NCCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)NCc1ccncc1 |
| InChI | InChI=1S/C18H17N5O5/c24-16-14-3-2-13(23(27)28)10-15(14)17(25)22(16)9-1-6-20-18(26)21-11-12-4-7-19-8-5-12/h2-5,7-8,10H,1,6,9,11H2,(H2,20,21,26) |
| InChIKey | AIOZJCMYIHRQGD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 134.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|