C18H14F2N4O5 — CID 108890215
1-(2,6-difluorophenyl)-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea (PubChem CID 108890215) has the molecular formula C18H14F2N4O5 and a molecular weight of 404.33 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 108890215 |
| Molecular Formula | C18H14F2N4O5 |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea |
| SMILES | O=C(NCCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C18H14F2N4O5/c19-13-3-1-4-14(20)15(13)22-18(27)21-7-2-8-23-16(25)11-6-5-10(24(28)29)9-12(11)17(23)26/h1,3-6,9H,2,7-8H2,(H2,21,22,27) |
| InChIKey | UHVRPFFZNSLMRZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|