C22H23N5O6 — CID 108890263
1-(2-morpholin-4-ylphenyl)-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea (PubChem CID 108890263) has the molecular formula C22H23N5O6 and a molecular weight of 453.46 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylphenyl)-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea.
| Compound Name | 1-(2-morpholin-4-ylphenyl)-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 108890263 |
| Molecular Formula | C22H23N5O6 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 1-(2-morpholin-4-ylphenyl)-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea |
| SMILES | O=C(NCCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C22H23N5O6/c28-20-16-7-6-15(27(31)32)14-17(16)21(29)26(20)9-3-8-23-22(30)24-18-4-1-2-5-19(18)25-10-12-33-13-11-25/h1-2,4-7,14H,3,8-13H2,(H2,23,24,30) |
| InChIKey | ZNCPPJRCVUEIOC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|