C18H25N5O3 — CID 108889439
1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-(2-piperazin-1-ylethyl)urea (PubChem CID 108889439) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-(2-piperazin-1-ylethyl)urea.
| Compound Name | 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-(2-piperazin-1-ylethyl)urea |
|---|---|
| PubChem CID | 108889439 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-(2-piperazin-1-ylethyl)urea |
| SMILES | O=C(NCCCN1C(=O)c2ccccc2C1=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C18H25N5O3/c24-16-14-4-1-2-5-15(14)17(25)23(16)10-3-6-20-18(26)21-9-13-22-11-7-19-8-12-22/h1-2,4-5,19H,3,6-13H2,(H2,20,21,26) |
| InChIKey | DASSURDVZPVUNV-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|